Introduction：Basic information about CAS 4079-61-2|dibenzyl 2-aminosuccinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dibenzyl 2-aminosuccinate |
|---|
| CAS Number | 4079-61-2 | Molecular Weight | 313.34800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Dibenzyl aspartate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H19NO4 |
|---|
| Molecular Weight | 313.34800 |
|---|
| Exact Mass | 313.13100 |
|---|
| PSA | 78.62000 |
|---|
| LogP | 2.89090 |
|---|
| InChIKey | BQAMWLOABQRMAO-UHFFFAOYSA-N |
|---|
| SMILES | NC(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| dibenzyl DL-aspartate |
| DL-aspartic acid dibenzyl ester |
| aspartic acid dibenzyl ester |
| (2S),2-amino-succinic acid dibenzyl ester |
| allyl dibenzyl malonate |
| DL-Asparaginsaeure-dibenzylester |
| dibenzyl allylmalonate |
| 2-amino-succinic acid dibenzyl ester |
| Propanedioic acid,2-propenyl-,bis(phenylmethyl) ester |
