Introduction:Basic information about CAS 844891-07-2|1-biphenylenecarbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-biphenylenecarbonyl chloride |
|---|
| CAS Number | 844891-07-2 | Molecular Weight | 214.64700 |
|---|
| Density | 1.391g/cm3 | Boiling Point | 343.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H7ClO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162ºC |
|---|
Names
| Name | biphenylene-1-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.391g/cm3 |
|---|
| Boiling Point | 343.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H7ClO |
|---|
| Molecular Weight | 214.64700 |
|---|
| Flash Point | 162ºC |
|---|
| Exact Mass | 214.01900 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.71300 |
|---|
| Index of Refraction | 1.782 |
|---|
| InChIKey | NLSBARINANPMGB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cccc2c1=c1ccccc1=2 |
|---|
Synonyms
| biphenylenecarbonyl chloride |
| 1-biphenylenecarbonyl chloride |