Introduction:Basic information about CAS 4236-05-9|1-Bromo-4-nitronaphthalene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-4-nitronaphthalene |
|---|
| CAS Number | 4236-05-9 | Molecular Weight | 252.064 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 355.9±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.0±20.9 °C |
|---|
Names
| Name | 1-Bromo-4-nitronaphthalene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 355.9±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrNO2 |
|---|
| Molecular Weight | 252.064 |
|---|
| Flash Point | 169.0±20.9 °C |
|---|
| Exact Mass | 250.958176 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.78 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.696 |
|---|
| InChIKey | OUENKLKXUFZIPK-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Br)c2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-Bromo-4-nitronaphthalin |
| Naphthalene, 1-bromo-4-nitro- |
| 1-Brom-4-nitro-naphthalin |
| Benzene,1-bromo-4-decyl |
| 1-bromo-4-n-decyl benzene |
| 4-bromo-1-nitronaphthalene |
| 4-Brom-1-nitronaphthalin |
| 1-Bromo-4-nitronaphthalene |
| 4-Decylbromobenzene |
| p-decylphenylbromide |
| 4-bromo-1-decylbenzene |
| 4-decyl-1-bromobenzene |
| 1-bromo-4-nitro-naphthalene |