Introduction：Basic information about CAS 157437-38-2|5-chloro-8-quinolinetrifluoromethanesul&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-chloro-8-quinolinetrifluoromethanesul& |
|---|
| CAS Number | 157437-38-2 | Molecular Weight | 311.66500 |
|---|
| Density | 1.639g/cm3 | Boiling Point | 386.394ºC at 760 mmHg |
|---|
| Molecular Formula | C10H5ClF3NO3S | Melting Point | 79-83ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 187.484ºC |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | (5-chloroquinolin-8-yl) trifluoromethanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.639g/cm3 |
|---|
| Boiling Point | 386.394ºC at 760 mmHg |
|---|
| Melting Point | 79-83ºC(lit.) |
|---|
| Molecular Formula | C10H5ClF3NO3S |
|---|
| Molecular Weight | 311.66500 |
|---|
| Flash Point | 187.484ºC |
|---|
| Exact Mass | 310.96300 |
|---|
| PSA | 64.64000 |
|---|
| LogP | 4.19740 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | ICTAEAXUAWQHSL-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Oc1ccc(Cl)c2cccnc12)C(F)(F)F |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H300-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P264-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T |
|---|
| Risk Phrases | R25 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 5-Chloro-8-quinolinetriflate |
| 5-Chloro-8-quinolinetrifluoromethanesulfonate |
| I08-1180 |
| 5-chloro-8-(trifluoromethylsulfonyloxy)-quinoline |
| 5-chloro-8-trifluoromethanesulfonyloxyquinoline |
| Methanesulfonic acid,trifluoro-,5-chloro-8-quinolinyl ester |
| MFCD07369729 |
