Introduction:Basic information about CAS 4039-31-0|Diethyl 2-(2-oxocyclohexyl)malonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethyl 2-(2-oxocyclohexyl)malonate |
|---|
| CAS Number | 4039-31-0 | Molecular Weight | 256.29500 |
|---|
| Density | 1.124g/cm3 | Boiling Point | 337.982ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.995ºC |
|---|
Names
| Name | diethyl 2-(2-oxocyclohexyl)propanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.124g/cm3 |
|---|
| Boiling Point | 337.982ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20O5 |
|---|
| Molecular Weight | 256.29500 |
|---|
| Flash Point | 145.995ºC |
|---|
| Exact Mass | 256.13100 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 1.48810 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.471 |
|---|
| InChIKey | DDSRUIQCMVMASX-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(=O)OCC)C1CCCCC1=O |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Cyclohexanon-(2)-yl-(1)-malonsaeure-diaethylester |
| A6762 |
| (2-Oxo-cyclohexyl)-malonsaeure-diaethylester |
| diethyl 2-oxocyclohexyl malonate |
| (2-oxo-cyclohexyl)-malonic acid diethyl ester |
| ethyl C-(2-oxocyclohexyl)malonate |
| Cyclohexanon-(2)-malonester |
| diethyl2-(2-oxocyclohexyl)malonate |