Introduction：Basic information about CAS 125802-42-8|6-amino-2-chloropurine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-amino-2-chloropurine |
|---|
| CAS Number | 125802-42-8 | Molecular Weight | 349.81700 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 519ºC at 760mmHg |
|---|
| Molecular Formula | C19H16ClN5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 267.7ºC |
|---|
Names
| Name | 2-chloro-9-[(4-methylphenyl)methyl]-N-phenylpurin-6-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 519ºC at 760mmHg |
|---|
| Molecular Formula | C19H16ClN5 |
|---|
| Molecular Weight | 349.81700 |
|---|
| Flash Point | 267.7ºC |
|---|
| Exact Mass | 349.10900 |
|---|
| PSA | 55.63000 |
|---|
| LogP | 4.65300 |
|---|
| Vapour Pressure | 7.13E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.691 |
|---|
| InChIKey | OYEKUVZUFASBGC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(Cn2cnc3c(Nc4ccccc4)nc(Cl)nc32)cc1 |
|---|
Synonyms
| 2-chloro-9-(4-methylbenzyl)-n-phenyl-9h-purin-6-amine |
| 6-Anilino-9-benzyl-2-chloro-9H-purines |
| ZLD0213 |
| 6-anilino-2-chloro-9-(4-methylbenzyl)-9H-purine |
