Introduction:Basic information about CAS 148-07-2|(E)-4-[3,4-bis(4-chlorophenyl)butan-2-ylamino]-4-oxobut-2-enoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-4-[3,4-bis(4-chlorophenyl)butan-2-ylamino]-4-oxobut-2-enoic acid |
|---|
| CAS Number | 148-07-2 | Molecular Weight | 392.27600 |
|---|
| Density | 1.302g/cm3 | Boiling Point | 595.4ºC at 760mmHg |
|---|
| Molecular Formula | C20H19Cl2NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 313.9ºC |
|---|
Names
| Name | (E)-4-[3,4-bis(4-chlorophenyl)butan-2-ylamino]-4-oxobut-2-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.302g/cm3 |
|---|
| Boiling Point | 595.4ºC at 760mmHg |
|---|
| Molecular Formula | C20H19Cl2NO3 |
|---|
| Molecular Weight | 392.27600 |
|---|
| Flash Point | 313.9ºC |
|---|
| Exact Mass | 391.07400 |
|---|
| PSA | 69.89000 |
|---|
| LogP | 5.30550 |
|---|
| Vapour Pressure | 5.05E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | NKPCAAMLVDTZOB-KHPPLWFESA-N |
|---|
| SMILES | CC(NC(=O)C=CC(=O)O)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|---|
Synonyms
| MK 135 |
| Benzmaleceno |
| Benzmalecene |
| Benzmalecenum |
| UNII-6ET4K804XA |