Introduction:Basic information about CAS 117337-19-6|fluthiacet-methyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fluthiacet-methyl |
|---|
| CAS Number | 117337-19-6 | Molecular Weight | 403.87900 |
|---|
| Density | 1.57 g/cm3 | Boiling Point | 503.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15ClFN3O3S2 | Melting Point | 104.6ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 258.3ºC |
|---|
| Symbol | GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | fluthiacet-methyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.57 g/cm3 |
|---|
| Boiling Point | 503.5ºC at 760 mmHg |
|---|
| Melting Point | 104.6ºC |
|---|
| Molecular Formula | C15H15ClFN3O3S2 |
|---|
| Molecular Weight | 403.87900 |
|---|
| Flash Point | 258.3ºC |
|---|
| Exact Mass | 403.02300 |
|---|
| PSA | 119.13000 |
|---|
| LogP | 2.79510 |
|---|
| Vapour Pressure | 2.9E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | ZCNQYNHDVRPZIH-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)CSc1cc(N=c2sc(=O)n3n2CCCC3)c(F)cc1Cl |
|---|
Safety Information
| Symbol | GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319-H400 |
|---|
| Precautionary Statements | P273-P305 + P351 + P338 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
| HS Code | 2930909056 |
|---|
Customs
| HS Code | 2930909056 |
|---|
| Summary | 2930909056 2,6-dichlorobenzothioamide。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|---|
Synonyms
| methyl {2-chloro-4-fluoro-5-[(EZ)-5,6,7,8-tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylideneamino]phenylthio}acetate |
| eluthiacet-methyl |
| Action |
| KIH 9201 |
| Fluthiacet-methyl |
| methyl 2-[[2-chloro-4-fluoro-5-[(tetrahydro-3-oxo-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]thio]acetate |
| Methyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
| methyl [(2-chloro-4-fluoro-5-{[(1Ξ)-3-oxo-5,6,7,8-tetrahydro-1H,3H-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene]amino}phenyl)sulfanyl]acetate |