Introduction：Basic information about CAS 6883-91-6|4-[[2-methoxy-4-[3-methoxy-4-[[3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-y, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[[2-methoxy-4-[3-methoxy-4-[[3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]diazenyl]phenyl]phenyl]diazenyl]-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one |
|---|
| CAS Number | 6883-91-6 | Molecular Weight | 642.70600 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 855.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34N8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 471ºC |
|---|
Names
| Name | 4-[[2-methoxy-4-[3-methoxy-4-[[3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]diazenyl]phenyl]phenyl]diazenyl]-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 855.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34N8O4 |
|---|
| Molecular Weight | 642.70600 |
|---|
| Flash Point | 471ºC |
|---|
| Exact Mass | 642.27000 |
|---|
| PSA | 133.24000 |
|---|
| LogP | 6.73880 |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | CMBVJWXIWKNGIL-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(-c2ccc(N=NC3C(=O)N(c4ccc(C)cc4)N=C3C)c(OC)c2)ccc1N=NC1C(=O)N(c2ccc(C)cc2)N=C1C |
|---|
