Introduction：Basic information about CAS 68877-63-4|N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-[(2-cyanoethyl)allylamino]-4-methoxyph, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-[(2-cyanoethyl)allylamino]-4-methoxyphenyl]acetamide |
|---|
| CAS Number | 68877-63-4 | Molecular Weight | 546.33100 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 780ºC at 760 mmHg |
|---|
| Molecular Formula | C21H20BrN7O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 425.5ºC |
|---|
Names
| Name | N-[2-[(2-bromo-4,6-dinitrophenyl)diazenyl]-5-[2-cyanoethyl(prop-2-enyl)amino]-4-methoxyphenyl]acetamide |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 780ºC at 760 mmHg |
|---|
| Molecular Formula | C21H20BrN7O6 |
|---|
| Molecular Weight | 546.33100 |
|---|
| Flash Point | 425.5ºC |
|---|
| Exact Mass | 545.06600 |
|---|
| PSA | 185.21000 |
|---|
| LogP | 7.24988 |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | WUAQCCUTLFMZFP-UHFFFAOYSA-N |
|---|
| SMILES | C=CCN(CCC#N)c1cc(NC(C)=O)c(N=Nc2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
|---|
