Introduction：Basic information about CAS 30536-55-1|2,8-Dihydroxy-4-quinolinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,8-Dihydroxy-4-quinolinecarboxylic acid |
|---|
| CAS Number | 30536-55-1 | Molecular Weight | 205.16700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H7NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 8-hydroxy-2-oxo-1H-quinoline-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H7NO4 |
|---|
| Molecular Weight | 205.16700 |
|---|
| Exact Mass | 205.03800 |
|---|
| PSA | 90.65000 |
|---|
| LogP | 1.34420 |
|---|
| InChIKey | DVEVPRIOUKVFAM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(=O)[nH]c2c(O)cccc12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 8-hydroxy-2-oxo-1,2-dihydro-quinoline-4-carboxylic acid |
| 4-Quinolinecarboxylicacid,1,2-dihydro-8-hydroxy-2-oxo |
| 2,8-dihydroxy-4-quinolinecarboxylic acid |
| 8-hydroxy-2-quinolone-4-carboxylic acid |
| zeanic acid |
| 8-Hydroxy-2-oxo-1,2-dihydrocinchoninic-acid |
