Introduction:Basic information about CAS 832-58-6|2',4',6'-Trimethoxyacetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2',4',6'-Trimethoxyacetophenone |
|---|
| CAS Number | 832-58-6 | Molecular Weight | 210.227 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 343.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14O4 | Melting Point | 98-102 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 152.0±26.5 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-(2,4,6-trimethoxyphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 343.0±37.0 °C at 760 mmHg |
|---|
| Melting Point | 98-102 °C(lit.) |
|---|
| Molecular Formula | C11H14O4 |
|---|
| Molecular Weight | 210.227 |
|---|
| Flash Point | 152.0±26.5 °C |
|---|
| Exact Mass | 210.089203 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 1.81 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.495 |
|---|
| InChIKey | KPZWHZSIXZXDMW-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)c(C(C)=O)c(OC)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2914509090 |
|---|
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-(2,4,6-Trimethoxyphenyl)ethanone |
| Ethanone, 1-(2,4,6-trimethoxyphenyl)- |
| 2',4',6'-Trimethoxyacetophenone |
| 2',4',6'-trimethoxyphenylacetophenone |
| 2-acetyl-1,3,5-trimethoxybenzene |
| phloracetophenone trimethyl ether |
| phloroacetophenone trimethylether |
| O-Methylxanthoxylin |
| MFCD00017238 |
| 2,4,6-trimethoxyacetophenone |
| 1-acetyl-2,4,6-trimethoxybenzene |