Introduction：Basic information about CAS 709-49-9|2,4-Dinitroiodobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dinitroiodobenzene |
|---|
| CAS Number | 709-49-9 | Molecular Weight | 294.00300 |
|---|
| Density | 2.174 g/cm3 | Boiling Point | 351.8ºC at 760 mmHg |
|---|
| Molecular Formula | C6H3IN2O4 | Melting Point | 86-88 °C(lit.) |
|---|
| MSDS | / | Flash Point | 166.6ºC |
|---|
Names
| Name | 2,4-dinitroiodobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.174 g/cm3 |
|---|
| Boiling Point | 351.8ºC at 760 mmHg |
|---|
| Melting Point | 86-88 °C(lit.) |
|---|
| Molecular Formula | C6H3IN2O4 |
|---|
| Molecular Weight | 294.00300 |
|---|
| Flash Point | 166.6ºC |
|---|
| Exact Mass | 293.91400 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 3.15400 |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | FXMKXMJLXRTQSW-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(I)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R42/43 |
|---|
| Safety Phrases | S22-S26-S37 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| EINECS 211-908-3 |
| MFCD00039738 |
| 2,4-Dinitroiodobenzene |
| 1-iodo-2,4-dinitrobenzene |
