Introduction：Basic information about CAS 5747-46-6|11-Morpholino-dibenzo[b,f][1,4]thiazepine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 11-Morpholino-dibenzo[b,f][1,4]thiazepine |
|---|
| CAS Number | 5747-46-6 | Molecular Weight | 431.252 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H13BrF2N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-bromo-N-[[2-(difluoromethoxy)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Molecular Formula | C16H13BrF2N2O3S |
|---|
| Molecular Weight | 431.252 |
|---|
| Exact Mass | 429.979828 |
|---|
| PSA | 102.21000 |
|---|
| LogP | 3.86 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | KWTXAMKTVXUNSP-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc2c(c1)N=C(N1CCOCC1)c1ccccc1S2 |
|---|
Synonyms
| 5-Bromo-N-{[2-(difluoromethoxy)phenyl]carbamothioyl}-2-methoxybenzamide |
| Benzamide, 5-bromo-N-[[[2-(difluoromethoxy)phenyl]amino]thioxomethyl]-2-methoxy- |
| 11-Morpholino-dibenzo[b,f][1,4]thiazepine |
| Quetiapine Impurity 10 |
