Introduction：Basic information about CAS 42740-50-1|2,2',3,3',4,4',5,6'-PCB, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2',3,3',4,4',5,6'-PCB |
|---|
| CAS Number | 42740-50-1 | Molecular Weight | 429.768 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 434.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H2Cl8 | Melting Point | 150.67°C (estimate) |
|---|
| MSDS | / | Flash Point | 215.4±24.7 °C |
|---|
Names
| Name | 2,2',3,3',4,4',5,6'-Octachlorobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 434.6±40.0 °C at 760 mmHg |
|---|
| Melting Point | 150.67°C (estimate) |
|---|
| Molecular Formula | C12H2Cl8 |
|---|
| Molecular Weight | 429.768 |
|---|
| Flash Point | 215.4±24.7 °C |
|---|
| Exact Mass | 425.766479 |
|---|
| LogP | 7.54 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | BQFCCUSDZLKBJG-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cc(-c2c(Cl)cc(Cl)c(Cl)c2Cl)c(Cl)c(Cl)c1Cl |
|---|
Synonyms
| 2,2',3,3',4,4',5,6'-PCB |
| 2,2',3,3',4,4',5,6'-Octachloro-1,1'-biphenyl |
| 1,2,3,4-tetrachloro-5-(2,3,4,6-tetrachlorophenyl)benzene |
| 2,2',3,3',4,4',5,6'-Octachlorobiphenyl |
| 1,1'-Biphenyl, 2,2',3,3',4,4',5,6'-octachloro- |
