Introduction：Basic information about CAS 57582-46-4|cinnamyl 3-oxobutanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cinnamyl 3-oxobutanoate |
|---|
| CAS Number | 57582-46-4 | Molecular Weight | 218.249 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 358.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.6±24.6 °C |
|---|
Names
| Name | cinnamyl 3-oxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 358.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H14O3 |
|---|
| Molecular Weight | 218.249 |
|---|
| Flash Point | 158.6±24.6 °C |
|---|
| Exact Mass | 218.094299 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.69 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | BDCAQAAKRKWXFW-YVMONPNESA-N |
|---|
| SMILES | CC(=O)CC(=O)OCC=Cc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Cinnamyl3-oxobutanoate |
| (2E)-3-Phenylprop-2-en-1-yl 3-oxobutanoate |
| cinnamyl acetoacetate |
| (2E)-3-Phenyl-2-propen-1-yl 3-oxobutanoate |
| Cinnamyl 3-oxobutanoate |
| Butanoic acid, 3-oxo-, (2E)-3-phenyl-2-propen-1-yl ester |
| Diacetic Acid Styracine |
