Introduction:Basic information about CAS 120728-10-1|N-Boc-1-aminocyclobutanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Boc-1-aminocyclobutanecarboxylic acid |
|---|
| CAS Number | 120728-10-1 | Molecular Weight | 215.246 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 362.1±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H17NO4 | Melting Point | 129-133 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 172.8±22.1 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | Boc-1-aminocyclobutane-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 362.1±21.0 °C at 760 mmHg |
|---|
| Melting Point | 129-133 °C(lit.) |
|---|
| Molecular Formula | C10H17NO4 |
|---|
| Molecular Weight | 215.246 |
|---|
| Flash Point | 172.8±22.1 °C |
|---|
| Exact Mass | 215.115753 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 1.16 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.500 |
|---|
| InChIKey | ROVVUKFHORPDSM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)O)CCC1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-Boc-1-Aminocyclobutanecarboxylic acid |
| 1-[(tert-Butoxycarbonyl)amino]cyclobutanecarboxylic acid |
| MFCD02682623 |
| Cyclobutanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 1-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclobutanecarboxylic acid |
| N-Boc-amino-1-cyclobutanecarboxylic acid |
| 1-(Boc-amino)cyclobutanecarboxylic Acid |
| 1-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid |
| 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |