Introduction：Basic information about CAS 5577-70-8|[Ethoxy(dimethyl)silyl]methyl methacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [Ethoxy(dimethyl)silyl]methyl methacrylate |
|---|
| CAS Number | 5577-70-8 | Molecular Weight | 202.323 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 200.3±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H18O3Si | Melting Point | <0ºC |
|---|
| MSDS | / | Flash Point | 62.4±18.2 °C |
|---|
Names
| Name | [ethoxy(dimethyl)silyl]methyl 2-methylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 200.3±23.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C9H18O3Si |
|---|
| Molecular Weight | 202.323 |
|---|
| Flash Point | 62.4±18.2 °C |
|---|
| Exact Mass | 202.102524 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 3.42 |
|---|
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.424 |
|---|
| InChIKey | DNQFCBLYUTWWCH-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)OC[Si](C)(C)OCC |
|---|
| Storage condition | below 5° C |
|---|
Safety Information
| Risk Phrases | 11-36/37/38 |
|---|
| Safety Phrases | 9-16-26-36 |
|---|
| RIDADR | UN 1993 |
|---|
Synonyms
| Methacrylicacid,(ethoxydimethylsilyl)methyl ester (6CI,7CI,8CI) |
| (Dimethylethoxysilyl)methylmethacrylate |
| (Ethoxy-dimethyl-silylmethyl)-methacrylat |
| (METHACRYLOXYMETHYL)DIMETHYLETHOXYSILANE |
| ethoxy-methacryloyloxymethyl-dimethyl-silane |
| 2-Propenoic acid,2-methyl-,(ethoxydimethylsilyl)methyl ester |
| methacryloyloxymethyl(dimethyl)ethoxysilane |
| 2-Propenoic acid, 2-methyl-, (ethoxydimethylsilyl)methyl ester |
| Methanol,(ethoxydimethylsilyl)-,methacrylate (8CI) |
| [Ethoxy(dimethyl)silyl]methyl methacrylate |
| Aethoxy-methacryloyloxymethyl-dimethyl-silan |
