Introduction：Basic information about CAS 1496-40-8|2-piperidino-5-(trifluoromethyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-piperidino-5-(trifluoromethyl)aniline |
|---|
| CAS Number | 1496-40-8 | Molecular Weight | 244.256 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 332.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15F3N2 | Melting Point | 41 °C |
|---|
| MSDS | / | Flash Point | 154.7±27.9 °C |
|---|
Names
| Name | n-(2-amino-4-trifluoromethylphenyl)piperidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 332.2±42.0 °C at 760 mmHg |
|---|
| Melting Point | 41 °C |
|---|
| Molecular Formula | C12H15F3N2 |
|---|
| Molecular Weight | 244.256 |
|---|
| Flash Point | 154.7±27.9 °C |
|---|
| Exact Mass | 244.118729 |
|---|
| PSA | 29.26000 |
|---|
| LogP | 3.83 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | BERRRZOJDANPHE-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
|---|
Safety Information
| Hazard Codes | Xi,F |
|---|
| Risk Phrases | R10:Flammable. R37:Irritating to the respiratory system. |
|---|
| Safety Phrases | S23-S24/25 |
|---|
| RIDADR | UN 1224 3/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Benzenamine, 2-(1-piperidinyl)-5-(trifluoromethyl)- |
| 3-AMINO-4-(1-PIPERIDINO)BENZOTRIFLUORIDE |
| 2-piperidin-1-yl-5-trifluoromethyl-aniline |
| MFCD00042161 |
| 2-piperidin-1-yl-5-(trifluoromethyl)aniline |
| 2-(piperidin-1-yl)-5-(trifluoromethyl)benzenamine |
| 2-piperidine-1-yl-5-trifluoromethyl-phenylamine |
| 2-(1-Piperidinyl)-5-(trifluoromethyl)aniline |
| 2-(piperidin-1-yl)-5-(trifluoromethyl)aniline |
| 2-piperidino-5-(trifluoromethyl)aniline |
| N-<2-Amino-4-trifluormethyl-phenyl>-piperidin |
| AKOS BB-8562 |
| 3-AMINO-4-PIPERIDINOBENZOTRIFLUORIDE |
