Introduction：Basic information about CAS 150609-95-3|Diacetonefructose chlorosulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diacetonefructose chlorosulfate |
|---|
| CAS Number | 150609-95-3 | Molecular Weight | 358.79200 |
|---|
| Density | 1.371 g/cm3 | Boiling Point | 406.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19ClO8S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3aS,5aR,8aR,8bS)-3a-(chlorosulfonyloxymethyl)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydrodi[1,3]dioxolo[4,5-a:5',3'-d]pyran |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.371 g/cm3 |
|---|
| Boiling Point | 406.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19ClO8S |
|---|
| Molecular Weight | 358.79200 |
|---|
| Exact Mass | 358.04900 |
|---|
| PSA | 97.90000 |
|---|
| LogP | 1.96550 |
|---|
| Vapour Pressure | 1.93E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.489 |
|---|
| InChIKey | RXVWCMYRBRBGMC-XBWDGYHZSA-N |
|---|
| SMILES | CC1(C)OC2COC3(COS(=O)(=O)Cl)OC(C)(C)OC3C2O1 |
|---|
Synonyms
| MFCD08458381 |
| 2,3:4,5-bis-O-(1-methylethylidene)-bD-Fructopyranose chlorosulfate |
| 2,2,7,7-tetramethyl-tetrahydro-bis[1,3]dioxolo[4,5-b:4',5'-d]pyran-3a-ylmethyl ester chlorosulfuric acid |
| Diacetonefructose chlorosulfate |
| O967 |
