Introduction：Basic information about CAS 53990-33-3|Z-Phg-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Phg-OH |
|---|
| CAS Number | 53990-33-3 | Molecular Weight | 285.295 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 495.3±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H15NO4 | Melting Point | 133 °C |
|---|
| MSDS | USA | Flash Point | 253.4±28.7 °C |
|---|
Names
| Name | (2S)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 495.3±45.0 °C at 760 mmHg |
|---|
| Melting Point | 133 °C |
|---|
| Molecular Formula | C16H15NO4 |
|---|
| Molecular Weight | 285.295 |
|---|
| Flash Point | 253.4±28.7 °C |
|---|
| Exact Mass | 285.100098 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.36 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | RLDJWBVOZVJJOS-AWEZNQCLSA-N |
|---|
| SMILES | O=C(NC(C(=O)O)c1ccccc1)OCc1ccccc1 |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-CBz-phenylglycine |
| Z-Phg-OH |
| (S)-2-(((Benzyloxy)carbonyl)amino)-2-phenylacetic acid |
| (2S)-{[(Benzyloxy)carbonyl]amino}(phenyl)acetic acid |
| (S)-Cbz-phenyl-Gly |
| Cbz-L-(+)-Phenylglycine |
| N-Carbobenzoxy-L-2-phenylglycine |
| MFCD00077033 |
| N-Cbz-L-phenylglycine |
| (S)-Cbz-phenylglycine |
| (2S)-N-Carboxybenzyl-2-phenylglycine |
| Z-L-phenylglycine |
| Cbz-Phg-OH |
| Benzeneacetic acid, α-[[(phenylmethoxy)carbonyl]amino]-, (αS)- |
| Z-L-2-phenylglycine |
| CBZ-L-Phenylglycine |
| Benzyloxycarbonyl-L-phenylglycine |
