Introduction：Basic information about CAS 14227-18-0|2,4,6-Trimethoxynitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4,6-Trimethoxynitrobenzene |
|---|
| CAS Number | 14227-18-0 | Molecular Weight | 213.18700 |
|---|
| Density | 1.23 g/cm3 | Boiling Point | 357.3ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO5 | Melting Point | 149-151 °C |
|---|
| MSDS | / | Flash Point | 169.9ºC |
|---|
Names
| Name | 1,3,5-trimethoxy-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23 g/cm3 |
|---|
| Boiling Point | 357.3ºC at 760 mmHg |
|---|
| Melting Point | 149-151 °C |
|---|
| Molecular Formula | C9H11NO5 |
|---|
| Molecular Weight | 213.18700 |
|---|
| Flash Point | 169.9ºC |
|---|
| Exact Mass | 213.06400 |
|---|
| PSA | 73.51000 |
|---|
| LogP | 2.14380 |
|---|
| Vapour Pressure | 5.67E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | VWYAWLZEMLQGJH-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)c([N+](=O)[O-])c(OC)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | 24/25 |
|---|
Synonyms
| MFCD00016992 |
| 1-Nitro-2,4,6-trimethoxybenzene |
| 1,3,5-trimethoxy-2-nitro-benzene |
| 1,3,5-Trimethoxy-2-nitro-benzol |
| 4-nitro-1,3,5-trimethoxybenzene |
| Nitrophloroglucin-trimethylaether |
| Benzene,1,3,5-trimethoxy-2-nitro |
| 1,3,5-trimethoxynitrobenzene |
