Introduction：Basic information about CAS 852181-10-3|5-(1,3-dioxolan-2-yl)furan-2-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(1,3-dioxolan-2-yl)furan-2-sulfonyl chloride |
|---|
| CAS Number | 852181-10-3 | Molecular Weight | 238.64500 |
|---|
| Density | 1.545g/cm3 | Boiling Point | 353.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H7ClO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.6ºC |
|---|
Names
| Name | 5-(1,3-dioxolan-2-yl)furan-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.545g/cm3 |
|---|
| Boiling Point | 353.6ºC at 760 mmHg |
|---|
| Molecular Formula | C7H7ClO5S |
|---|
| Molecular Weight | 238.64500 |
|---|
| Flash Point | 167.6ºC |
|---|
| Exact Mass | 237.97000 |
|---|
| PSA | 74.12000 |
|---|
| LogP | 2.33330 |
|---|
| Index of Refraction | 1.536 |
|---|
| InChIKey | IOYFFBBJOJZBMG-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(C2OCCO2)o1 |
|---|
Synonyms
| 2-Furansulfonylchloride,5-(1,3-dioxolan-2-yl) |
