Introduction:Basic information about CAS 219865-79-9|2-methyl-6-[(2,2,2-trifluoroacetyl)amino]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methyl-6-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
|---|
| CAS Number | 219865-79-9 | Molecular Weight | 247.17100 |
|---|
| Density | 1.473g/cm3 | Boiling Point | 350ºC at 760mmHg |
|---|
| Molecular Formula | C10H8F3NO3 | Melting Point | 168ºC |
|---|
| MSDS | / | Flash Point | 165.5ºC |
|---|
Names
| Name | 2-methyl-6-[(2,2,2-trifluoroacetyl)amino]benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.473g/cm3 |
|---|
| Boiling Point | 350ºC at 760mmHg |
|---|
| Melting Point | 168ºC |
|---|
| Molecular Formula | C10H8F3NO3 |
|---|
| Molecular Weight | 247.17100 |
|---|
| Flash Point | 165.5ºC |
|---|
| Exact Mass | 247.04600 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.26700 |
|---|
| Vapour Pressure | 1.69E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.541 |
|---|
| InChIKey | DMUDYGKPQIEHPM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(NC(=O)C(F)(F)F)c1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|