Introduction：Basic information about CAS 219539-02-3|2-[(6-chloro-4h-1,3-benzodioxin-8-yl)methoxy]-5-nitrobenzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(6-chloro-4h-1,3-benzodioxin-8-yl)methoxy]-5-nitrobenzaldehyde |
|---|
| CAS Number | 219539-02-3 | Molecular Weight | 349.72300 |
|---|
| Density | 1.466g/cm3 | Boiling Point | 574.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H12ClNO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 301.5ºC |
|---|
Names
| Name | 2-[(6-chloro-4h-1,3-benzodioxin-8-yl)methoxy]-5-nitrobenzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.466g/cm3 |
|---|
| Boiling Point | 574.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H12ClNO6 |
|---|
| Molecular Weight | 349.72300 |
|---|
| Flash Point | 301.5ºC |
|---|
| Exact Mass | 349.03500 |
|---|
| PSA | 90.58000 |
|---|
| LogP | 4.02940 |
|---|
| Vapour Pressure | 3.22E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | ZTYMPPYITZUTDB-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1OCc1cc(Cl)cc2c1OCOC2 |
|---|
