Introduction:Basic information about CAS 1198-33-0|1H-Purine-2,6-dione,3,9-dihydro-9-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Purine-2,6-dione,3,9-dihydro-9-methyl- |
|---|
| CAS Number | 1198-33-0 | Molecular Weight | 166.13700 |
|---|
| Density | 1.83g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H6N4O2 | Melting Point | >300ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 9-methyl-3H-purine-2,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.83g/cm3 |
|---|
| Melting Point | >300ºC |
|---|
| Molecular Formula | C6H6N4O2 |
|---|
| Molecular Weight | 166.13700 |
|---|
| Exact Mass | 166.04900 |
|---|
| PSA | 83.54000 |
|---|
| Index of Refraction | 1.827 |
|---|
| InChIKey | DHNIKYWYTSMDDA-UHFFFAOYSA-N |
|---|
| SMILES | Cn1cnc2c(=O)[nH]c(=O)[nH]c21 |
|---|
Safety Information
| Hazard Codes | T+ |
|---|
| Risk Phrases | R26/27/28 |
|---|
| Safety Phrases | 22-24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 9-methyl-3,9-dihydro-purine-2,6-dione |
| 9-Methyl-3,9-dihydro-purin-2,6-dion |
| EINECS 214-831-3 |
| 9-methyl xanthine |
| 3,9-dihydro-9-methyl-1H-purine-2,6-dione |
| 9-methyl-1H-purine-2,6(3H,9H)-dione |
| 2,6-Dihydroxy-9-methylpurine |
| 9-methyl-3,9-dihydro-1h-purine-2,6-dione |
| MFCD00042774 |