Introduction:Basic information about CAS 121845-60-1|4-(PYRIDO[3,4-E][1,2,4]TRIAZIN-3-YL)BENZONITRILE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(PYRIDO[3,4-E][1,2,4]TRIAZIN-3-YL)BENZONITRILE |
|---|
| CAS Number | 121845-60-1 | Molecular Weight | 233.22800 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 505.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H7N5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.9ºC |
|---|
Names
| Name | 4-pyrido[3,4-e][1,2,4]triazin-3-ylbenzonitrile |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 505.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H7N5 |
|---|
| Molecular Weight | 233.22800 |
|---|
| Flash Point | 156.9ºC |
|---|
| Exact Mass | 233.07000 |
|---|
| PSA | 75.35000 |
|---|
| LogP | 1.95848 |
|---|
| Vapour Pressure | 2.4E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.711 |
|---|
| InChIKey | KVYRBRIPUAHYGR-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(-c2nnc3ccncc3n2)cc1 |
|---|