Introduction：Basic information about CAS 57390-39-3|1-(4-Fluorophenyl)-1,1-dimethoxy-4-chlorobutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Fluorophenyl)-1,1-dimethoxy-4-chlorobutane |
|---|
| CAS Number | 57390-39-3 | Molecular Weight | 246.70600 |
|---|
| Density | 1.134g/cm3 | Boiling Point | 294.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16ClFO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 131.7ºC |
|---|
Names
| Name | 1-(4-chloro-1,1-dimethoxybutyl)-4-fluorobenzene |
|---|
Chemical & Physical Properties
| Density | 1.134g/cm3 |
|---|
| Boiling Point | 294.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16ClFO2 |
|---|
| Molecular Weight | 246.70600 |
|---|
| Flash Point | 131.7ºC |
|---|
| Exact Mass | 246.08200 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 3.29030 |
|---|
| Index of Refraction | 1.484 |
|---|
| InChIKey | STABNEURAMXABB-UHFFFAOYSA-N |
|---|
| SMILES | COC(CCCCl)(OC)c1ccc(F)cc1 |
|---|
