Introduction:Basic information about CAS 2117-50-2|Bis(trimethyltin)acetylene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(trimethyltin)acetylene |
|---|
| CAS Number | 2117-50-2 | Molecular Weight | 351.63100 |
|---|
| Density | / | Boiling Point | 219.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H18Sn2 | Melting Point | 59-61ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 86.1ºC |
|---|
| Symbol | GHS02, GHS06, GHS09 | Signal Word | Danger |
|---|
Names
| Name | bis(trimethylstannyl)acetylene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 219.3ºC at 760 mmHg |
|---|
| Melting Point | 59-61ºC(lit.) |
|---|
| Molecular Formula | C8H18Sn2 |
|---|
| Molecular Weight | 351.63100 |
|---|
| Flash Point | 86.1ºC |
|---|
| Exact Mass | 353.94500 |
|---|
| LogP | 2.74460 |
|---|
| Vapour Pressure | 0.177mmHg at 25°C |
|---|
| InChIKey | CDIFRACRLLNHOO-UHFFFAOYSA-N |
|---|
| SMILES | C[Sn](C)(C)C#C[Sn](C)(C)C |
|---|
Safety Information
| Symbol | GHS02, GHS06, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H228-H300 + H310 + H330-H410 |
|---|
| Precautionary Statements | P210-P260-P264-P273-P280-P284 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T+: Very toxic;N: Dangerous for the environment; |
|---|
| Risk Phrases | R26/27/28;R50/53 |
|---|
| Safety Phrases | 26-27-28-45-60-61 |
|---|
| RIDADR | UN 2926 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| BIS(TRIMETHYLTIN(IV))ACETYLENE |
| ethynylenebis[trimethylstannane] |
| bis(trimethylstanyl)ethyne |
| EINECS 218-324-8 |
| MFCD01073798 |
| Bis(trimethylstannyl)acetylene |
| 1,2-Ethynediylbis[trimethylstannane] Ethynylenebis[trimethyl]tin |
| 1,2-Ethynediylbis(trimethylstannane) |
| 1,2-Bis(trimethylstannyl)acetylene |
| bis(trimethyl)ethynyldistannane |
| Bis(trimethylstannyl)acetylen |
| Bis(trimethylstannyl)ethyne |
| 1,2-Bis(trimethylstannyl)ethyne |
| Bis(trimethyltin)acetylene |