Introduction：Basic information about CAS 150398-22-4|H-Phe-Arg-Arg-OH acetate salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-Phe-Arg-Arg-OH acetate salt |
|---|
| CAS Number | 150398-22-4 | Molecular Weight | 477.56100 |
|---|
| Density | 1.47g/cm3 | Boiling Point | 815.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H35N9O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 447.2ºC |
|---|
Names
| Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Boiling Point | 815.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H35N9O4 |
|---|
| Molecular Weight | 477.56100 |
|---|
| Flash Point | 447.2ºC |
|---|
| Exact Mass | 477.28100 |
|---|
| PSA | 245.32000 |
|---|
| LogP | 2.00110 |
|---|
| Vapour Pressure | 3.83E-28mmHg at 25°C |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | LZDIENNKWVXJMX-JYJNAYRXSA-N |
|---|
| SMILES | NC(N)=NCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1ccccc1)C(=O)O |
|---|
Synonyms
| Phenylalanyl-arginyl-arginine |
| Phe-arg-arg |
