Introduction：Basic information about CAS 147688-40-2|Fmoc-tyr(2-br-z)-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-tyr(2-br-z)-oh |
|---|
| CAS Number | 147688-40-2 | Molecular Weight | 616.455 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 791.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C32H26BrNO7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 432.4±32.9 °C |
|---|
Names
| Name | (2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 791.4±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C32H26BrNO7 |
|---|
| Molecular Weight | 616.455 |
|---|
| Flash Point | 432.4±32.9 °C |
|---|
| Exact Mass | 615.089233 |
|---|
| PSA | 111.16000 |
|---|
| LogP | 7.23 |
|---|
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | KDNBLNJKURMWNG-LJAQVGFWSA-N |
|---|
| SMILES | O=C(NC(Cc1ccc(OC(=O)OCc2ccccc2Br)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| AmbotzFAA1750 |
| Fmoc-L-Tyr(2-Br-Z)-OH |
| Fmoc-Tyr(2-Br-Z)-OH |
| L-Tyrosine, O-[[(2-bromophenyl)methoxy]carbonyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| O-{[(2-Bromobenzyl)oxy]carbonyl}-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-tyrosine |
