Introduction：Basic information about CAS 214852-34-3|fmoc-d-arg(boc)2-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-d-arg(boc)2-oh |
|---|
| CAS Number | 214852-34-3 | Molecular Weight | 596.671 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C31H40N4O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2R)-5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C31H40N4O8 |
|---|
| Molecular Weight | 596.671 |
|---|
| Exact Mass | 596.284607 |
|---|
| PSA | 164.65000 |
|---|
| LogP | 6.20 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | WPAALELGEWGQEG-XMMPIXPASA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(=NCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)NC(=O)OC(C)(C)C |
|---|
| Storage condition | -15°C |
|---|
Synonyms
| D-Ornithine, N-[bis[[(1,1-dimethylethoxy)carbonyl]amino]methylene]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-(2,2,10,10-tetramethyl-4,8-dioxo-3,9-dioxa-5,7-diazaundecan-6-ylidene)-D-ornithine |
| Fmoc-Nomega,Nomega'-bis-Boc-D-arginine |
