Introduction：Basic information about CAS 118476-89-4|Fmoc-D-Orn(Boc)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-D-Orn(Boc)-OH |
|---|
| CAS Number | 118476-89-4 | Molecular Weight | 454.516 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 679.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H30N2O6 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 364.5±31.5 °C |
|---|
Names
| Name | Fmoc-(Nd-Boc)-D-ornithine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 679.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H30N2O6 |
|---|
| Molecular Weight | 454.516 |
|---|
| Flash Point | 364.5±31.5 °C |
|---|
| Exact Mass | 454.210388 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 5.04 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | JOOIZTMAHNLNHE-OAQYLSRUSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
Synonyms
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}ornithine |
| (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| N-(tert-butoxycarbonyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-ornithine |
| FMOC-D-ORN(BOC)-OH |
| Ornithine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| N-Fmoc-N'-Boc-D-ornithine |
| D-ornithine, N-[(1,1-dimethylethoxy)carbonyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
