Introduction:Basic information about CAS 685513-91-1|1H-Pyrrolo[2,3-b]pyridine, 5-bromo-4-fluoro-1-[tris(1-methylethyl)silyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-4-fluoro-1-[tris(1-methylethyl)silyl]- |
|---|
| CAS Number | 685513-91-1 | Molecular Weight | 371.36300 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 334.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H24BrFN2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-4-fluoro-1-[tris(1-methylethyl)silyl] |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 334.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H24BrFN2Si |
|---|
| Molecular Weight | 371.36300 |
|---|
| Exact Mass | 370.08800 |
|---|
| PSA | 17.82000 |
|---|
| LogP | 5.96150 |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | AIJAFOFKGPWSSO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(F)c(Br)cnc21 |
|---|