CAS 142851-03-4|Ethyl N-Boc-piperidine-4-carboxylate
Introduction：Basic information about CAS 142851-03-4|Ethyl N-Boc-piperidine-4-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl N-Boc-piperidine-4-carboxylate | ||
|---|---|---|---|
| CAS Number | 142851-03-4 | Molecular Weight | 243.299 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 307.4±35.0 °C at 760 mmHg |
| Molecular Formula | C12H21NO4 | Melting Point | / |
| MSDS | ChineseUSA | Flash Point | 139.7±25.9 °C |
| Symbol | GHS05, GHS07 | Signal Word | Danger |
Names
| Name | Ethyl N-Boc-piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.4±35.0 °C at 760 mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.299 |
| Flash Point | 139.7±25.9 °C |
| Exact Mass | 243.147064 |
| PSA | 55.84000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | MYHJCTUTPIKNAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
Safety Information
| Symbol | GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R37/38;R41 |
| Safety Phrases | S26-S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
Customs
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Articles1
More ArticlesTetrahedron Lett. 48 , 1191, (2007) |
Synonyms
| 1-tert-butyl 4-methyl piperidine-1,4-dicarboxylate |
| 4-Methyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate |
| Ethyl N-BOC-4-piperidinecarboxylate |
| Methyl 1-Boc-4-piperidinecarboxylate |
| MFCD01763998 |
| Ethyl 1-(tert-Butoxycarbonyl)-4-piperidinecarboxylate |
| 1-Boc-4-piperidinecarboxylic Acid Ethyl Ester |
| Piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-ethyl ester |
| Ethyl 1-(tert-Butyloxycarbonyl)isonipecotate |
| Dimethylethyl piperidinedicarboxylic acid ethyl ester |
| Ethyl 1-Boc-4-piperidinecarboxylate |
| 4-Ethyl 1-(2-methyl-2-propanyl) 1,4-piperidinedicarboxylate |
| Methyl N-Boc-piperidine-4-carboxylate |
| N-Boc-4-Carbethoxy Piperidine |
| 1-Boc-4-piperidinecarboxylic Acid Methyl Ester |
| Piperidine-1,4-dicarboxylic Acid 1-tert-Butyl 4-Methyl Ester |
| 1-O-tert-butyl 4-O-methyl piperidine-1,4-dicarboxylate |
| 1-(tert-Butoxycarbonyl)-4-piperidinecarboxylic Acid Ethyl Ester |
| 1,4-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) 4-ethyl ester |
| 1-tert-Butyl 4-ethyl piperidine-1,4-dicarboxylate |
| 1,4-Piperidinedicarboxylic acid, 1-(1,1-dimethylethyl) 4-methyl ester |
| 1-tert-butyl-4-methylpiperidin-1,4-dicarboxylat |
| Piperidine-1,4-dicarboxylic Acid 1-tert-Butyl 4-Ethyl Ester |
| 1-(tert-Butoxycarbonyl)-4-piperidinecarboxylic Acid Methyl Ester |
| 1-N-Boc-4-Piperidinecarboxylic acid methyl ester |
| 1-O-tert-butyl 4-O-ethyl piperidine-1,4-dicarboxylate |
| Methyl 1-(tert-Butoxycarbonyl)-4-piperidinecarboxylate |
