Introduction：Basic information about CAS 19146-73-7|2-(o-tolylaminomethylene)malonic acid diethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(o-tolylaminomethylene)malonic acid diethyl ester |
|---|
| CAS Number | 19146-73-7 | Molecular Weight | 277.31600 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 346ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163ºC |
|---|
Names
| Name | 2-(o-tolylaminomethylene)malonic acid diethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 346ºC at 760 mmHg |
|---|
| Molecular Formula | C15H19NO4 |
|---|
| Molecular Weight | 277.31600 |
|---|
| Flash Point | 163ºC |
|---|
| Exact Mass | 277.13100 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 2.49000 |
|---|
| Vapour Pressure | 5.95E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | ZRZMZJLFPGQKKY-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=CNc1ccccc1C)C(=O)OCC |
|---|
Synonyms
| o-Toluidinomethylen-malonsaeure-diaethylester |
| o-toluidinomethylene-malonic acid diethyl ester |
