Introduction：Basic information about CAS 203626-33-9|8-CHLORO-2,6-DIMETHYL-4-QUINOLINOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-CHLORO-2,6-DIMETHYL-4-QUINOLINOL |
|---|
| CAS Number | 203626-33-9 | Molecular Weight | 207.65600 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 361.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 172.2ºC |
|---|
Names
| Name | 8-chloro-2,6-dimethyl-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 361.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO |
|---|
| Molecular Weight | 207.65600 |
|---|
| Flash Point | 172.2ºC |
|---|
| Exact Mass | 207.04500 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.21060 |
|---|
| Vapour Pressure | 1.01E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | YIWGDBDLPVIKSN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)c2[nH]c(C)cc(=O)c2c1 |
|---|
Synonyms
| 8-Chloro-2,6-dimethyl-4-quinolinol |
| 8-Chloro-2,6-dimethyl-4-hydroxyquinoline |
| QU065 |
