Introduction:Basic information about CAS 2693-61-0|3,5-DICHLORO-2,6-DIFLUORO-4-PYRIDINOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-DICHLORO-2,6-DIFLUORO-4-PYRIDINOL |
|---|
| CAS Number | 2693-61-0 | Molecular Weight | 199.97000 |
|---|
| Density | 1.7g/cm3 | Boiling Point | 173ºC at 760 mmHg |
|---|
| Molecular Formula | C5HCl2F2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 58.4ºC |
|---|
Names
| Name | haloxydine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7g/cm3 |
|---|
| Boiling Point | 173ºC at 760 mmHg |
|---|
| Molecular Formula | C5HCl2F2NO |
|---|
| Molecular Weight | 199.97000 |
|---|
| Flash Point | 58.4ºC |
|---|
| Exact Mass | 198.94000 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 2.37220 |
|---|
| Vapour Pressure | 1.29mmHg at 25°C |
|---|
| Index of Refraction | 1.519 |
|---|
| InChIKey | MJAWMRVEIWPJRW-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c(Cl)c(F)[nH]c(F)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,6-difluoro-3,5-dichloro-4-hydroxy pyridine |
| 3,5-dichloro-2,6-difluoro-4-hydroxypyridine |
| Caswell No. 304A |
| 4-hydroxy-3,5-dichloro-difluoropyridine |
| 3,5-dichloro-2,6-difluoropyridin-4-ol |
| 3,5-dichloro-2,6-difluoro-1H-pyridin-4-one |
| Haloxydine |
| 3,5-Dichloro-2,6-difluoro-4-pyridinol |
| 3,5-Dichlor-2,6-difluor-4-hydroxy-pyridin |
| 3,5-dichloro-2,6-difluoro-4-pyridinol |