Introduction：Basic information about CAS 55694-98-9|Ciclafrine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ciclafrine |
|---|
| CAS Number | 55694-98-9 | Molecular Weight | 247.33300 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 424.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H21NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.5ºC |
|---|
Names
| Name | Ciclafrine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 424.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H21NO2 |
|---|
| Molecular Weight | 247.33300 |
|---|
| Flash Point | 210.5ºC |
|---|
| Exact Mass | 247.15700 |
|---|
| PSA | 41.49000 |
|---|
| LogP | 3.43240 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | AJNAKEPPGKJNKU-UHFFFAOYSA-N |
|---|
| SMILES | Oc1cccc(C2CNC3(CCCCCC3)O2)c1 |
|---|
Synonyms
| Ciclafrina |
| Unii-76hzx0gvcd |
| Ciclafrinum |
