Introduction：Basic information about CAS 59010-44-5|Prizidilol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Prizidilol |
|---|
| CAS Number | 59010-44-5 | Molecular Weight | 331.41300 |
|---|
| Density | 1.193g/cm3 | Boiling Point | 595ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25N5O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 313.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.193g/cm3 |
|---|
| Boiling Point | 595ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25N5O2 |
|---|
| Molecular Weight | 331.41300 |
|---|
| Flash Point | 313.7ºC |
|---|
| Exact Mass | 331.20100 |
|---|
| PSA | 105.32000 |
|---|
| LogP | 2.72120 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | QGONODUKOFNSOY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)NCC(O)COc1ccccc1-c1ccc(NN)nn1 |
|---|
