Introduction：Basic information about CAS 91-39-4|2-Nitro 4' Chloro Diphenyl Ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Nitro 4' Chloro Diphenyl Ether |
|---|
| CAS Number | 91-39-4 | Molecular Weight | 249.65000 |
|---|
| Density | 1.358 | Boiling Point | 334.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClNO3 | Melting Point | 36-37ºC |
|---|
| MSDS | / | Flash Point | 156.1ºC |
|---|
Names
| Name | 2-Nitro-4-chlorodiphenylether |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.358 |
|---|
| Boiling Point | 334.5ºC at 760 mmHg |
|---|
| Melting Point | 36-37ºC |
|---|
| Molecular Formula | C12H8ClNO3 |
|---|
| Molecular Weight | 249.65000 |
|---|
| Flash Point | 156.1ºC |
|---|
| Exact Mass | 249.01900 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 4.56370 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | OJESLZHZRVDKCA-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1Oc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| (4-Chlor-2-nitro-phenyl)-phenyl-aether |
| 4-chloro-2-nitro-1-phenoxy-benzene |
| (4-Chlor-2-nitro-phenyl)-phenyl-ether |
| (4-chloro-2-nitro-phenyl)-phenyl ether |
| 2-Nitro 4' Chloro Diphenyl Ether |
| 4-chloro-2-nitrodiphenyl ether |
| 4-Chlor-2-nitro-diphenylaether |
