Introduction:Basic information about CAS 154554-67-3|2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine |
|---|
| CAS Number | 154554-67-3 | Molecular Weight | 261.40200 |
|---|
| Density | 0.98g/cm3 | Boiling Point | 322ºC at 760 mmHg |
|---|
| Molecular Formula | C17H27NO | Melting Point | 40-45ºC |
|---|
| MSDS | / | Flash Point | 110ºC |
|---|
Names
| Name | 2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.98g/cm3 |
|---|
| Boiling Point | 322ºC at 760 mmHg |
|---|
| Melting Point | 40-45ºC |
|---|
| Molecular Formula | C17H27NO |
|---|
| Molecular Weight | 261.40200 |
|---|
| Flash Point | 110ºC |
|---|
| Exact Mass | 261.20900 |
|---|
| PSA | 12.47000 |
|---|
| LogP | 4.66020 |
|---|
| Vapour Pressure | 0.000288mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | WURBRXPDUPECQX-UHFFFAOYSA-N |
|---|
| SMILES | CC(ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
Synonyms
| N-(|A-Methylbenzyloxy)-2,2,6,6-tetramethylpiperidine |
| 1-(1-Phenylethoxy)-2,2,6,6-tetramethylpiperidine |
| 1-(1-phenylethyl)oxy-2,2,6,6-tetramethylpiperidine |
| 1-(2,2,6,6-tetramethylpiperidin-1-yloxy)-1-phenylethane |
| 1-phenyl-1-(2,2,6,6-tetramethyl-1-piperidinyloxy)ethane |
| Piperidine,2,2,6,6-tetramethyl-1-(1-phenylethoxy) |
| N-(1-phenylethoxy)-2,2,6,6-tetramethylpiperidine |
| 1-phenyl-1-(2,2,6,6-tetramethylpiperidinoxy)ethane |
| 2,2,5,7-TETRAMETHYLTETRALINE |