Introduction：Basic information about CAS 75484-39-8|4-Fluoro-N-(4-piperidinyl)benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Fluoro-N-(4-piperidinyl)benzamide |
|---|
| CAS Number | 75484-39-8 | Molecular Weight | 222.259 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 387.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15FN2O | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 188.3±26.5 °C |
|---|
Names
| Name | 4-Fluoro-N-piperidin-4-yl-benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 387.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15FN2O |
|---|
| Molecular Weight | 222.259 |
|---|
| Flash Point | 188.3±26.5 °C |
|---|
| Exact Mass | 222.116837 |
|---|
| PSA | 41.13000 |
|---|
| LogP | 1.79 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | IQRBPUVIUQDULO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NC1CCNCC1)c1ccc(F)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Fluoro-N-(4-piperidinyl)benzamide |
| 4-(4-fluoroanilino)-piperidine |
| (fluoro-4 anilino)-4 piperidine |
| N-(4-fluorophenyl)-4-piperidinamine |
| 4-(4-fluoro-2-nitro-phenoxy)-1-methyl-piperidine |
| (4-Fluoro-phenyl)-piperidin-4yl-amine |
| 4-(4-fluorobenzamido)piperidine |
| Piperidine,4-(4-fluoro-2-nitrophenoxy)-1-methyl |
| 4-[(4-fluorophenyl)amino]piperidine |
| N-(piperidin-4-yl)-4-fluorobenzamide |
| 4-Fluoro-N-(piperidin-4-yl)benzamide |
| Benzamide, 4-fluoro-N-4-piperidinyl- |
