Introduction:Basic information about CAS 307531-92-6|1 3 5 7 9 11 14-HEPTAISOBUTYLTRICYCLO, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1 3 5 7 9 11 14-HEPTAISOBUTYLTRICYCLO |
|---|
| CAS Number | 307531-92-6 | Molecular Weight | 791.41500 |
|---|
| Density | 1.08g/cm3 | Boiling Point | 560.9ºC at 760 mmHg |
|---|
| Molecular Formula | C28H66O12Si7 | Melting Point | 139-143ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 293ºC |
|---|
Names
| Name | 1,3,5,7,9,11,14-Heptaisobutyltricyclo[7.3.3.15,11]heptasiloxane-endo-3,7,14-triol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.08g/cm3 |
|---|
| Boiling Point | 560.9ºC at 760 mmHg |
|---|
| Melting Point | 139-143ºC(lit.) |
|---|
| Molecular Formula | C28H66O12Si7 |
|---|
| Molecular Weight | 791.41500 |
|---|
| Flash Point | 293ºC |
|---|
| Exact Mass | 790.29400 |
|---|
| PSA | 143.76000 |
|---|
| LogP | 6.31780 |
|---|
| Index of Refraction | 1.48 |
|---|
| InChIKey | APIBTMSFBUJAAC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C[Si]1(O)O[Si]2(CC(C)C)O[Si](O)(CC(C)C)O[Si]3(CC(C)C)O[Si](O)(CC(C)C)O[Si](CC(C)C)(O1)O[Si](CC(C)C)(O2)O3 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| trisilanoisobutyl-POSS |
| tricyclo[7.3.3.15,11]heptasiloxane-3,7,14-triol-1,3,5,7,9,11,14-heptakis(2-methylpropyl) |
| 1,3,5,7,9,11,14-heptaisobutyltricyclo[7.3.3.1(5,11)]heptasiloxane-endo-3,7,14-triol |
| isobutyl silsesquioxane |
| Isobutyltrisilanol-POSS(R) |
| trisilanol-iBu-POSS |
| MFCD02683450 |
| 1,3,5,7,9,11,14-heptaisobutyltricyclo[7,3,3,1(5,14)]heptasiloxane-3,7,11-trisilanol |