Introduction:Basic information about CAS 432-08-6|1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N,N-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridec, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N,N-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)hexan-1-amine |
|---|
| CAS Number | 432-08-6 | Molecular Weight | 971.13700 |
|---|
| Density | 1.777g/cm3 | Boiling Point | 250-260ºC |
|---|
| Molecular Formula | C18F39N | Melting Point | 33ºC |
|---|
| MSDS | / | Flash Point | 124.5ºC |
|---|
Names
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N,N-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)hexan-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.777g/cm3 |
|---|
| Boiling Point | 250-260ºC |
|---|
| Melting Point | 33ºC |
|---|
| Molecular Formula | C18F39N |
|---|
| Molecular Weight | 971.13700 |
|---|
| Flash Point | 124.5ºC |
|---|
| Exact Mass | 970.94100 |
|---|
| PSA | 3.24000 |
|---|
| LogP | 12.37730 |
|---|
| Vapour Pressure | 0.00339mmHg at 25°C |
|---|
| Index of Refraction | 1.299 |
|---|
| InChIKey | HDCGZKPLSIIZAZ-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN 3265 |
|---|
| HS Code | 2921199090 |
|---|
Customs
| HS Code | 2921199090 |
|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| tris-tridecafluorohexyl-amine |
| Perfluorotrihexylamine |
| Tris-tridecafluorhexyl-amin |
| PC6220G |