Introduction：Basic information about CAS 19590-55-7|Estra-1,3,5(10)-triene-3,17-diol,2,4-dibromo-, (17b)-(9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Estra-1,3,5(10)-triene-3,17-diol,2,4-dibromo-, (17b)-(9CI) |
|---|
| CAS Number | 19590-55-7 | Molecular Weight | 430.17400 |
|---|
| Density | 1.623g/cm3 | Boiling Point | 454.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H22Br2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.9ºC |
|---|
Names
| Name | 2,4-dibromo-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.623g/cm3 |
|---|
| Boiling Point | 454.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H22Br2O2 |
|---|
| Molecular Weight | 430.17400 |
|---|
| Flash Point | 228.9ºC |
|---|
| Exact Mass | 427.99900 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 5.13420 |
|---|
| Vapour Pressure | 4.61E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | UTXNYGUZJLLOSP-UHFFFAOYSA-N |
|---|
| SMILES | CC12CCC3c4cc(Br)c(O)c(Br)c4CCC3C1CCC2O |
|---|
Synonyms
| (8R)-2.4-Dibrom-3.17c-dihydroxy-13c-methyl-(8rH.9tH.14tH)-7.8.9.11.12.13.14.15.16.17-decahydro-6H-cyclopenta[a]phenanthren |
| 2,4-dibromoestra-1(10),2,4-triene-3,17-diol |
| (17beta)-2,4-dibromoestra-1(10),2,4-triene-3,17-diol |
| 2,4-dibromoestradiol |
