Introduction：Basic information about CAS 55249-70-2|2,6-Dibromospiro[3.3]heptane-2,6-dicarboxylic ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dibromospiro[3.3]heptane-2,6-dicarboxylic ac |
|---|
| CAS Number | 55249-70-2 | Molecular Weight | 398.08800 |
|---|
| Density | 1.65g/cm3 | Boiling Point | 369.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H18Br2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.2ºC |
|---|
Names
| Name | diethyl 2,6-dibromospiro[3.3]heptane-2,6-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65g/cm3 |
|---|
| Boiling Point | 369.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H18Br2O4 |
|---|
| Molecular Weight | 398.08800 |
|---|
| Flash Point | 177.2ºC |
|---|
| Exact Mass | 395.95700 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.95400 |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | XAMKLIDFYSWIFP-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1(Br)CC2(C1)CC(Br)(C(=O)OCC)C2 |
|---|
Synonyms
| 2,6-Dibrom-spiro[3.3]heptan-2,6-dicarbonsaeure-diaethylester |
| 2,6-dibromo-spiro[3.3]heptane-2,6-dicarboxylic acid diethyl ester |
