Introduction:Basic information about CAS 1136-01-2|Benzenepropanoic acid,4-methoxy-b,b-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoic acid,4-methoxy-b,b-dimethyl- |
|---|
| CAS Number | 1136-01-2 | Molecular Weight | 208.25400 |
|---|
| Density | 1.088g/cm3 | Boiling Point | 332.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 124.4ºC |
|---|
Names
| Name | 3-(4-methoxyphenyl)-3-methylbutanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.088g/cm3 |
|---|
| Boiling Point | 332.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16O3 |
|---|
| Molecular Weight | 208.25400 |
|---|
| Flash Point | 124.4ºC |
|---|
| Exact Mass | 208.11000 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.44750 |
|---|
| Vapour Pressure | 5.64E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.513 |
|---|
| InChIKey | LFQSLLJGDHNKAR-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(C)(C)CC(=O)O)cc1 |
|---|