Introduction:Basic information about CAS 5421-53-4|Bis(4-tert-butylphenyl)iodonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(4-tert-butylphenyl)iodonium chloride |
|---|
| CAS Number | 5421-53-4 | Molecular Weight | 429.78600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H27ClI+ | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | bis(4-tert-butylphenyl)iodanium,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C20H27ClI+ |
|---|
| Molecular Weight | 429.78600 |
|---|
| Exact Mass | 429.08500 |
|---|
| LogP | 3.21200 |
|---|
| InChIKey | JHPUIEDIXRYPTP-UHFFFAOYSA-M |
|---|
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.[Cl-] |
|---|
Safety Information
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Bis-(4-tert-butyl-phenyl)-diazen-N-oxid |
| bis(p-tert-butylphenyl)iodonium chloride |
| 4,4'-Di-tert-butyldiphenyliodonium chloride |
| bis-(4-tert-butyl-phenyl)-diazene-N-oxide |
| Bis-(4-tert-butyl-phenyl)-jodonium,Chlorid |
| bis (4-t-butylphenyl)iodonium chloride |
| bis-(4-tert-butyl-phenyl)-iodonium,chloride |
| 4,4'-Di-(t-butyl)-azoxybenzol |
| 1-tert-butyl-4-[(z)-(4-tert-butylphenyl)-nno-azoxy]benzene |
| 4,4'-Di-tert.-butylazoxybenzol |
| Bis(4-tert-butylphenyl)iodonium chloride |