Introduction：Basic information about CAS 40017-83-2|3-(2-Nitrophenyl)-3-oxopropanenitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2-Nitrophenyl)-3-oxopropanenitrile |
|---|
| CAS Number | 40017-83-2 | Molecular Weight | 190.156 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 399.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.2±22.3 °C |
|---|
Names
| Name | 3-(2-nitrophenyl)-3-oxopropanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 399.2±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6N2O3 |
|---|
| Molecular Weight | 190.156 |
|---|
| Flash Point | 195.2±22.3 °C |
|---|
| Exact Mass | 190.037842 |
|---|
| PSA | 86.68000 |
|---|
| LogP | 0.58 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | WHJVFNZAENXWGO-UHFFFAOYSA-N |
|---|
| SMILES | N#CCC(=O)c1ccccc1[N+](=O)[O-] |
|---|
Synonyms
| 3-(2-NITROPHENYL)-3-OXOPROPIONITRILE |
| 3-(2-Nitrophenyl)-3-oxopropanenitrile |
| 3-(2-Nitro-phenyl)-3-oxo-propionitril |
| o-nitrophenacylcyanide |
| BEN363 |
| 3-(2-Nitrophenyl)-3-oxopropionsaeurenitril |
| Benzenepropanenitrile, 2-nitro-β-oxo- |
| o-Nitrophenacylcyanid |
